C22H19F3N2O5 — CID 72608905
[2-[C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxycarbonimidoyl]phenyl] 3-[3-(trifluoromethyl)phenyl]but-2-enoate (PubChem CID 72608905) has the molecular formula C22H19F3N2O5 and a molecular weight of 448.40 g/mol. Its IUPAC name is [2-[C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxycarbonimidoyl]phenyl] 3-[3-(trifluoromethyl)phenyl]but-2-enoate.
| Compound Name | [2-[C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxycarbonimidoyl]phenyl] 3-[3-(trifluoromethyl)phenyl]but-2-enoate |
|---|---|
| PubChem CID | 72608905 |
| Molecular Formula | C22H19F3N2O5 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [2-[C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxycarbonimidoyl]phenyl] 3-[3-(trifluoromethyl)phenyl]but-2-enoate |
| SMILES | CON=C(C1=NOCCO1)c1ccccc1OC(=O)C=C(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F3N2O5/c1-14(15-6-5-7-16(13-15)22(23,24)25)12-19(28)32-18-9-4-3-8-17(18)20(26-29-2)21-27-31-11-10-30-21/h3-9,12-13H,10-11H2,1-2H3 |
| InChIKey | NECPIXXCCGRKKO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|