C22H20N4O5 — CID 72607694
1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxy-1-[2-(4-phenylmethoxypyrimidin-2-yl)oxyphenyl]methanimine (PubChem CID 72607694) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxy-1-[2-(4-phenylmethoxypyrimidin-2-yl)oxyphenyl]methanimine.
| Compound Name | 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxy-1-[2-(4-phenylmethoxypyrimidin-2-yl)oxyphenyl]methanimine |
|---|---|
| PubChem CID | 72607694 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxy-1-[2-(4-phenylmethoxypyrimidin-2-yl)oxyphenyl]methanimine |
| SMILES | CON=C(C1=NOCCO1)c1ccccc1Oc1nccc(OCc2ccccc2)n1 |
| InChI | InChI=1S/C22H20N4O5/c1-27-25-20(21-26-30-14-13-28-21)17-9-5-6-10-18(17)31-22-23-12-11-19(24-22)29-15-16-7-3-2-4-8-16/h2-12H,13-15H2,1H3 |
| InChIKey | MWJQEZMQYIKEJI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|