C23H23N3O6 — CID 139714669
benzyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(N-methoxy-C-methylcarbonimidoyl)benzoate (PubChem CID 139714669) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is benzyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(N-methoxy-C-methylcarbonimidoyl)benzoate.
| Compound Name | benzyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(N-methoxy-C-methylcarbonimidoyl)benzoate |
|---|---|
| PubChem CID | 139714669 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | benzyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(N-methoxy-C-methylcarbonimidoyl)benzoate |
| SMILES | CON=C(C)c1cccc(Oc2nc(OC)cc(OC)n2)c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H23N3O6/c1-15(26-30-4)17-11-8-12-18(32-23-24-19(28-2)13-20(25-23)29-3)21(17)22(27)31-14-16-9-6-5-7-10-16/h5-13H,14H2,1-4H3 |
| InChIKey | XOPYZNJVIGZODR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|