About benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate
benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate (PubChem CID 19876588) has the molecular formula C20H18ClN3O4
and a molecular weight of 399.83 g/mol. Its IUPAC name is benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate.
Molecular Properties
| Compound Name | benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate |
| PubChem CID | 19876588 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate |
| SMILES | COc1cc(OC)nc(Nc2cccc(Cl)c2C(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C20H18ClN3O4/c1-26-16-11-17(27-2)24-20(23-16)22-15-10-6-9-14(21)18(15)19(25)28-12-13-7-4-3-5-8-13/h3-11H,12H2,1-2H3,(H,22,23,24) |
| InChIKey | SQUYSOVEKDOCMC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate?
The IUPAC name of benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate (CID 19876588) is benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate.
What is the SMILES notation for benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate?
The canonical SMILES for benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate is COc1cc(OC)nc(Nc2cccc(Cl)c2C(=O)OCc2ccccc2)n1.
What is the InChIKey of benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate?
The InChIKey is SQUYSOVEKDOCMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClN3O4/c1-26-16-11-17(27-2)24-20(23-16)22-15-10-6-9-14(21)18(15)19(25)28-12-13-7-4-3-5-8-13/h3-11H,12H2,1-2H3,(H,22,23,24).
What are the key properties of benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate?
benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate has a molecular weight of 399.83 g/mol, XLogP of 4.25, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)amino]benzoate is sourced from PubChem (CID 19876588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).