C17H20N4O5 — CID 86747762
methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-6-(N-methoxy-C-methylcarbonimidoyl)benzoate (PubChem CID 86747762) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-6-(N-methoxy-C-methylcarbonimidoyl)benzoate.
| Compound Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-6-(N-methoxy-C-methylcarbonimidoyl)benzoate |
|---|---|
| PubChem CID | 86747762 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-6-(N-methoxy-C-methylcarbonimidoyl)benzoate |
| SMILES | CON=C(C)c1cccc(Nc2nc(OC)cc(OC)n2)c1C(=O)OC |
| InChI | InChI=1S/C17H20N4O5/c1-10(21-26-5)11-7-6-8-12(15(11)16(22)25-4)18-17-19-13(23-2)9-14(20-17)24-3/h6-9H,1-5H3,(H,18,19,20) |
| InChIKey | FBYIFHGLTOVTTK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|