C18H22N3O6+ — CID 54060138
1-[3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-methoxycarbonylphenyl]ethylidene-ethyl-hydroxyazanium (PubChem CID 54060138) has the molecular formula C18H22N3O6+ and a molecular weight of 376.39 g/mol. Its IUPAC name is 1-[3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-methoxycarbonylphenyl]ethylidene-ethyl-hydroxyazanium.
| Compound Name | 1-[3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-methoxycarbonylphenyl]ethylidene-ethyl-hydroxyazanium |
|---|---|
| PubChem CID | 54060138 |
| Molecular Formula | C18H22N3O6+ |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-[3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-methoxycarbonylphenyl]ethylidene-ethyl-hydroxyazanium |
| SMILES | CC[N+](O)=C(C)c1cccc(Oc2nc(OC)cc(OC)n2)c1C(=O)OC |
| InChI | InChI=1S/C18H22N3O6/c1-6-21(23)11(2)12-8-7-9-13(16(12)17(22)26-5)27-18-19-14(24-3)10-15(20-18)25-4/h7-10,23H,6H2,1-5H3/q+1 |
| InChIKey | BWRSHIUMZNGQFT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|