C5H2FIN4O2 — CID 163856805
2-fluoro-5-iodo-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione (PubChem CID 163856805) has the molecular formula C5H2FIN4O2 and a molecular weight of 296.00 g/mol. Its IUPAC name is 2-fluoro-5-iodo-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione.
| Compound Name | 2-fluoro-5-iodo-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 163856805 |
| Molecular Formula | C5H2FIN4O2 |
| Molecular Weight | 296.00 g/mol |
| Exact Mass | 295.92 |
| IUPAC Name | 2-fluoro-5-iodo-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
| SMILES | O=c1[nH]c2nn(F)cc2c(=O)n1I |
| InChI | InChI=1S/C5H2FIN4O2/c6-10-1-2-3(9-10)8-5(13)11(7)4(2)12/h1H,(H,8,9,13) |
| InChIKey | OYZQIRCMMZRYMY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.00 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|