C6H6N4O3 — CID 135426869
5-hydroxy-2-methyl-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione (PubChem CID 135426869) has the molecular formula C6H6N4O3 and a molecular weight of 182.14 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione.
| Compound Name | 5-hydroxy-2-methyl-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 135426869 |
| Molecular Formula | C6H6N4O3 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 5-hydroxy-2-methyl-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
| SMILES | Cn1cc2c(=O)n(O)c(=O)[nH]c2n1 |
| InChI | InChI=1S/C6H6N4O3/c1-9-2-3-4(8-9)7-6(12)10(13)5(3)11/h2,13H,1H3,(H,7,8,12) |
| InChIKey | OPNIJJNIGLYAHI-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|