C18H25NO2 — CID 163857598
1-[3-(2-methylphenyl)-1-(oxan-3-yl)pyrrolidin-3-yl]ethanone (PubChem CID 163857598) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-[3-(2-methylphenyl)-1-(oxan-3-yl)pyrrolidin-3-yl]ethanone.
| Compound Name | 1-[3-(2-methylphenyl)-1-(oxan-3-yl)pyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 163857598 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-[3-(2-methylphenyl)-1-(oxan-3-yl)pyrrolidin-3-yl]ethanone |
| SMILES | CC(=O)C1(c2ccccc2C)CCN(C2CCCOC2)C1 |
| InChI | InChI=1S/C18H25NO2/c1-14-6-3-4-8-17(14)18(15(2)20)9-10-19(13-18)16-7-5-11-21-12-16/h3-4,6,8,16H,5,7,9-13H2,1-2H3 |
| InChIKey | OZQVRBOCIHTATM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |