C20H34N3O5+ — CID 163857682
[3-[5-(cyclohexa-2,4-dien-1-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]oxiran-2-yl]azanium (PubChem CID 163857682) has the molecular formula C20H34N3O5+ and a molecular weight of 396.51 g/mol. Its IUPAC name is [3-[5-(cyclohexa-2,4-dien-1-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]oxiran-2-yl]azanium.
| Compound Name | [3-[5-(cyclohexa-2,4-dien-1-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]oxiran-2-yl]azanium |
|---|---|
| PubChem CID | 163857682 |
| Molecular Formula | C20H34N3O5+ |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | [3-[5-(cyclohexa-2,4-dien-1-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]oxiran-2-yl]azanium |
| SMILES | CC(C)(C)OC(=O)NC(CCCCNC(=O)OCC1C=CC=CC1)C1OC1[NH3+] |
| InChI | InChI=1S/C20H33N3O5/c1-20(2,3)28-19(25)23-15(16-17(21)27-16)11-7-8-12-22-18(24)26-13-14-9-5-4-6-10-14/h4-6,9,14-17H,7-8,10-13,21H2,1-3H3,(H,22,24)(H,23,25)/p+1 |
| InChIKey | OZSYMAURDITJLN-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 116.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|