C27H16F3N3O3S — CID 163863395
(3,4-diphenyl-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaen-9-yl) trifluoromethanesulfonate (PubChem CID 163863395) has the molecular formula C27H16F3N3O3S and a molecular weight of 519.50 g/mol. Its IUPAC name is (3,4-diphenyl-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaen-9-yl) trifluoromethanesulfonate.
| Compound Name | (3,4-diphenyl-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaen-9-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 163863395 |
| Molecular Formula | C27H16F3N3O3S |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | (3,4-diphenyl-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaen-9-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c3cccnc3n3c(-c4ccccc4)c(-c4ccccc4)nc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C27H16F3N3O3S/c28-27(29,30)37(34,35)36-19-13-14-20-21-12-7-15-31-25(21)33-24(18-10-5-2-6-11-18)23(17-8-3-1-4-9-17)32-26(33)22(20)16-19/h1-16H |
| InChIKey | CKPZLTDZNQZLSO-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|