C19H26N2O4 — CID 163864065
2-(aminomethyl)-4-[1-hydroxy-2-[1-(2-methoxyphenoxy)propan-2-ylamino]ethyl]phenol (PubChem CID 163864065) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-(aminomethyl)-4-[1-hydroxy-2-[1-(2-methoxyphenoxy)propan-2-ylamino]ethyl]phenol.
| Compound Name | 2-(aminomethyl)-4-[1-hydroxy-2-[1-(2-methoxyphenoxy)propan-2-ylamino]ethyl]phenol |
|---|---|
| PubChem CID | 163864065 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-(aminomethyl)-4-[1-hydroxy-2-[1-(2-methoxyphenoxy)propan-2-ylamino]ethyl]phenol |
| SMILES | COc1ccccc1OCC(C)NCC(O)c1ccc(O)c(CN)c1 |
| InChI | InChI=1S/C19H26N2O4/c1-13(12-25-19-6-4-3-5-18(19)24-2)21-11-17(23)14-7-8-16(22)15(9-14)10-20/h3-9,13,17,21-23H,10-12,20H2,1-2H3 |
| InChIKey | MFCOFFWBBUPUDM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|