C9H13N2O15P3-2 — CID 163865222
[[[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxoniophosphoryl]oxy-oxidophosphoryl] phosphate (PubChem CID 163865222) has the molecular formula C9H13N2O15P3-2 and a molecular weight of 482.12 g/mol. Its IUPAC name is [[[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxoniophosphoryl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxoniophosphoryl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 163865222 |
| Molecular Formula | C9H13N2O15P3-2 |
| Molecular Weight | 482.12 g/mol |
| Exact Mass | 481.95 |
| IUPAC Name | [[[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxoniophosphoryl]oxy-oxidophosphoryl] phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)([OH2+])OP(=O)([O-])OP(=O)([O-])[O-])C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H15N2O15P3/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H,10,12,15)(H2,16,17,18)/p-2/t4-,6?,7?,8-/m1/s1 |
| InChIKey | PGAVKCOVUIYSFO-AYZDMWBASA-L |
| XLogP | -4.66 |
| TPSA | 275.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.12 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|