C12H20N2O7 — CID 163865606
(2S)-2-acetamido-4-hydroxybutanoic acid;N-[(3S)-2-oxooxolan-3-yl]acetamide (PubChem CID 163865606) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is (2S)-2-acetamido-4-hydroxybutanoic acid;N-[(3S)-2-oxooxolan-3-yl]acetamide.
| Compound Name | (2S)-2-acetamido-4-hydroxybutanoic acid;N-[(3S)-2-oxooxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 163865606 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2S)-2-acetamido-4-hydroxybutanoic acid;N-[(3S)-2-oxooxolan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H](CCO)C(=O)O.CC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C6H11NO4.C6H9NO3/c1-4(9)7-5(2-3-8)6(10)11;1-4(8)7-5-2-3-10-6(5)9/h5,8H,2-3H2,1H3,(H,7,9)(H,10,11);5H,2-3H2,1H3,(H,7,8)/t2*5-/m00/s1 |
| InChIKey | PGISXSIDJAPUJT-ZLELNMGESA-N |
| XLogP | -1.60 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |