C13H14N2O — CID 163867412
2,3-diamino-4-(4-methylphenyl)cyclohexa-2,4-dien-1-one (PubChem CID 163867412) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 2,3-diamino-4-(4-methylphenyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 2,3-diamino-4-(4-methylphenyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 163867412 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2,3-diamino-4-(4-methylphenyl)cyclohexa-2,4-dien-1-one |
| SMILES | Cc1ccc(C2=CCC(=O)C(N)=C2N)cc1 |
| InChI | InChI=1S/C13H14N2O/c1-8-2-4-9(5-3-8)10-6-7-11(16)13(15)12(10)14/h2-6H,7,14-15H2,1H3 |
| InChIKey | PHVGIZMFIHNXBU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |