About CID 163868361
CID 163868361 (PubChem CID 163868361) has the molecular formula C34H51BN6O6S
and a molecular weight of 682.70 g/mol.
Molecular Properties
| Compound Name | CID 163868361 |
| PubChem CID | 163868361 |
| Molecular Formula | C34H51BN6O6S |
| Molecular Weight | 682.70 g/mol |
| Exact Mass | 682.37 |
| IUPAC Name | — |
| SMILES | [B][C@@]1(C(C)OC)CC[C@H](C)CCN[C@@H](C)[C@H]2N(C/C=C/Cn3cc(-c4nccs4)nn3)C(=O)O[C@]2(C)[C@@H](CC)OC(=O)[C@H](C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C34H51BN6O6S/c1-9-27-33(7)29(41(32(44)47-33)18-11-10-17-40-20-26(38-39-40)30-37-16-19-48-30)24(5)36-15-13-21(2)12-14-34(35,25(6)45-8)23(4)28(42)22(3)31(43)46-27/h10-11,16,19-25,27,29,36H,9,12-15,17-18H2,1-8H3/b11-10+/t21-,22+,23-,24-,25?,27+,29+,33+,34-/m0/s1 |
| InChIKey | DUAOCFOLSFFZDU-NRBCXZRVSA-N |
| XLogP | 4.86 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 682.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 163868361 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163868361?
The IUPAC name of CID 163868361 (CID 163868361) is not available.
What is the SMILES notation for CID 163868361?
The canonical SMILES for CID 163868361 is [B][C@@]1(C(C)OC)CC[C@H](C)CCN[C@@H](C)[C@H]2N(C/C=C/Cn3cc(-c4nccs4)nn3)C(=O)O[C@]2(C)[C@@H](CC)OC(=O)[C@H](C)C(=O)[C@@H]1C.
What is the InChIKey of CID 163868361?
The InChIKey is DUAOCFOLSFFZDU-NRBCXZRVSA-N. The full InChI is InChI=1S/C34H51BN6O6S/c1-9-27-33(7)29(41(32(44)47-33)18-11-10-17-40-20-26(38-39-40)30-37-16-19-48-30)24(5)36-15-13-21(2)12-14-34(35,25(6)45-8)23(4)28(42)22(3)31(43)46-27/h10-11,16,19-25,27,29,36H,9,12-15,17-18H2,1-8H3/b11-10+/t21-,22+,23-,24-,25?,27+,29+,33+,34-/m0/s1.
What are the key properties of CID 163868361?
CID 163868361 has a molecular weight of 682.70 g/mol, XLogP of 4.86, 8 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163868361 is sourced from PubChem (CID 163868361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).