C20H37+ — CID 163869089
4-[1-[(2R)-2,3-dimethylcyclopropyl]ethyl]-1-hexan-2-yl-1-methylcyclohexane (PubChem CID 163869089) has the molecular formula C20H37+ and a molecular weight of 277.52 g/mol. Its IUPAC name is 4-[1-[(2R)-2,3-dimethylcyclopropyl]ethyl]-1-hexan-2-yl-1-methylcyclohexane.
| Compound Name | 4-[1-[(2R)-2,3-dimethylcyclopropyl]ethyl]-1-hexan-2-yl-1-methylcyclohexane |
|---|---|
| PubChem CID | 163869089 |
| Molecular Formula | C20H37+ |
| Molecular Weight | 277.52 g/mol |
| Exact Mass | 277.29 |
| IUPAC Name | 4-[1-[(2R)-2,3-dimethylcyclopropyl]ethyl]-1-hexan-2-yl-1-methylcyclohexane |
| SMILES | CCCCC(C)C1(C)[CH+]CC(C(C)C2C(C)[C@H]2C)CC1 |
| InChI | InChI=1S/C20H37/c1-7-8-9-14(2)20(6)12-10-18(11-13-20)17(5)19-15(3)16(19)4/h12,14-19H,7-11,13H2,1-6H3/q+1/t14?,15-,16?,17?,18?,19?,20?/m1/s1 |
| InChIKey | PJFIYBIZQWRBGX-BWOYLUMYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|