C27H32N2O4S — CID 163869311
2-[4-[[3-(cyclopropylmethoxy)-5-(3-morpholin-4-ylprop-1-ynyl)phenyl]methylsulfanyl]-2-methylphenoxy]acetamide (PubChem CID 163869311) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is 2-[4-[[3-(cyclopropylmethoxy)-5-(3-morpholin-4-ylprop-1-ynyl)phenyl]methylsulfanyl]-2-methylphenoxy]acetamide.
| Compound Name | 2-[4-[[3-(cyclopropylmethoxy)-5-(3-morpholin-4-ylprop-1-ynyl)phenyl]methylsulfanyl]-2-methylphenoxy]acetamide |
|---|---|
| PubChem CID | 163869311 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 2-[4-[[3-(cyclopropylmethoxy)-5-(3-morpholin-4-ylprop-1-ynyl)phenyl]methylsulfanyl]-2-methylphenoxy]acetamide |
| SMILES | Cc1cc(SCc2cc(C#CCN3CCOCC3)cc(OCC3CC3)c2)ccc1OCC(N)=O |
| InChI | InChI=1S/C27H32N2O4S/c1-20-13-25(6-7-26(20)33-18-27(28)30)34-19-23-14-22(3-2-8-29-9-11-31-12-10-29)15-24(16-23)32-17-21-4-5-21/h6-7,13-16,21H,4-5,8-12,17-19H2,1H3,(H2,28,30) |
| InChIKey | PJJYNQANDXCZQZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|