C26H27N3O2 — CID 163869699
N-[2-amino-1-(3-methylphenyl)ethyl]-2-methoxy-5-(3-methyl-1H-isoindol-5-yl)benzamide (PubChem CID 163869699) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[2-amino-1-(3-methylphenyl)ethyl]-2-methoxy-5-(3-methyl-1H-isoindol-5-yl)benzamide.
| Compound Name | N-[2-amino-1-(3-methylphenyl)ethyl]-2-methoxy-5-(3-methyl-1H-isoindol-5-yl)benzamide |
|---|---|
| PubChem CID | 163869699 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[2-amino-1-(3-methylphenyl)ethyl]-2-methoxy-5-(3-methyl-1H-isoindol-5-yl)benzamide |
| SMILES | COc1ccc(-c2ccc3c(c2)C(C)=NC3)cc1C(=O)NC(CN)c1cccc(C)c1 |
| InChI | InChI=1S/C26H27N3O2/c1-16-5-4-6-20(11-16)24(14-27)29-26(30)23-13-19(9-10-25(23)31-3)18-7-8-21-15-28-17(2)22(21)12-18/h4-13,24H,14-15,27H2,1-3H3,(H,29,30) |
| InChIKey | ZHVHNOAWVUTXBK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |