C27H29N3O — CID 163439112
N-[2-amino-2-methyl-1-(3-methylphenyl)propyl]-3-(3-methyl-1H-isoindol-5-yl)benzamide (PubChem CID 163439112) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[2-amino-2-methyl-1-(3-methylphenyl)propyl]-3-(3-methyl-1H-isoindol-5-yl)benzamide.
| Compound Name | N-[2-amino-2-methyl-1-(3-methylphenyl)propyl]-3-(3-methyl-1H-isoindol-5-yl)benzamide |
|---|---|
| PubChem CID | 163439112 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N-[2-amino-2-methyl-1-(3-methylphenyl)propyl]-3-(3-methyl-1H-isoindol-5-yl)benzamide |
| SMILES | CC1=NCc2ccc(-c3cccc(C(=O)NC(c4cccc(C)c4)C(C)(C)N)c3)cc21 |
| InChI | InChI=1S/C27H29N3O/c1-17-7-5-9-21(13-17)25(27(3,4)28)30-26(31)22-10-6-8-19(14-22)20-11-12-23-16-29-18(2)24(23)15-20/h5-15,25H,16,28H2,1-4H3,(H,30,31) |
| InChIKey | CNFFMSGKPJHUNH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |