C25H26N4O — CID 163763298
N-[2-(dimethylamino)-1-(3-methylphenyl)ethyl]-3-(1H-indazol-5-yl)benzamide (PubChem CID 163763298) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)-1-(3-methylphenyl)ethyl]-3-(1H-indazol-5-yl)benzamide.
| Compound Name | N-[2-(dimethylamino)-1-(3-methylphenyl)ethyl]-3-(1H-indazol-5-yl)benzamide |
|---|---|
| PubChem CID | 163763298 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | N-[2-(dimethylamino)-1-(3-methylphenyl)ethyl]-3-(1H-indazol-5-yl)benzamide |
| SMILES | Cc1cccc(C(CN(C)C)NC(=O)c2cccc(-c3ccc4[nH]ncc4c3)c2)c1 |
| InChI | InChI=1S/C25H26N4O/c1-17-6-4-8-20(12-17)24(16-29(2)3)27-25(30)21-9-5-7-18(13-21)19-10-11-23-22(14-19)15-26-28-23/h4-15,24H,16H2,1-3H3,(H,26,28)(H,27,30) |
| InChIKey | LLKUSPOJQFOFNZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |