C10H14O5 — CID 163870853
(3aR,6R,6aR)-6-hydroxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,3'-cyclobutane]-1'-one (PubChem CID 163870853) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (3aR,6R,6aR)-6-hydroxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,3'-cyclobutane]-1'-one.
| Compound Name | (3aR,6R,6aR)-6-hydroxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,3'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 163870853 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (3aR,6R,6aR)-6-hydroxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,3'-cyclobutane]-1'-one |
| SMILES | CC1(C)O[C@H]2OC3(CC(=O)C3)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C10H14O5/c1-9(2)13-6-7(12)10(3-5(11)4-10)15-8(6)14-9/h6-8,12H,3-4H2,1-2H3/t6-,7-,8+/m1/s1 |
| InChIKey | PKQRRIXGTUEZGX-PRJMDXOYSA-N |
| XLogP | -0.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |