C11H18O5 — CID 158335200
1-[(3aR,5R,6S,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropan-2-one (PubChem CID 158335200) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-[(3aR,5R,6S,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropan-2-one.
| Compound Name | 1-[(3aR,5R,6S,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropan-2-one |
|---|---|
| PubChem CID | 158335200 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-[(3aR,5R,6S,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-hydroxypropan-2-one |
| SMILES | C[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CC(=O)CO |
| InChI | InChI=1S/C11H18O5/c1-6-8(4-7(13)5-12)14-10-9(6)15-11(2,3)16-10/h6,8-10,12H,4-5H2,1-3H3/t6-,8+,9+,10+/m0/s1 |
| InChIKey | NZJMRCQFFJQVRQ-JZKKDOLYSA-N |
| XLogP | 0.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |