C13H22O7 — CID 25107877
ethyl (2R,3R)-3-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3-dihydroxypropanoate (PubChem CID 25107877) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3-dihydroxypropanoate.
| Compound Name | ethyl (2R,3R)-3-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 25107877 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | ethyl (2R,3R)-3-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C13H22O7/c1-5-17-11(16)8(15)7(14)9-6(2)10-12(18-9)20-13(3,4)19-10/h6-10,12,14-15H,5H2,1-4H3/t6-,7-,8-,9+,10-,12-/m1/s1 |
| InChIKey | INFNLRPGRQCVMA-XHTBWLONSA-N |
| XLogP | -0.22 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |