C12H20O5 — CID 58058293
5-[(5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-hydroxypentan-2-one (PubChem CID 58058293) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-[(5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-hydroxypentan-2-one.
| Compound Name | 5-[(5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-hydroxypentan-2-one |
|---|---|
| PubChem CID | 58058293 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5-[(5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-hydroxypentan-2-one |
| SMILES | CC1(C)OC2O[C@H](CCCC(=O)CO)C[C@H]2O1 |
| InChI | InChI=1S/C12H20O5/c1-12(2)16-10-6-9(15-11(10)17-12)5-3-4-8(14)7-13/h9-11,13H,3-7H2,1-2H3/t9-,10-,11?/m1/s1 |
| InChIKey | DVEGINXATWIYOB-DIOIDXFWSA-N |
| XLogP | 0.98 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |