C33H52O7 — CID 163873506
(4R,6S)-6-[[(4S,9S,12R,14S,17S,21R,22S)-22-(2-hydroxypropan-2-yl)-8,8,17-trimethyl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-9-yl]oxy]oxane-3,4-diol (PubChem CID 163873506) has the molecular formula C33H52O7 and a molecular weight of 560.77 g/mol. Its IUPAC name is (4R,6S)-6-[[(4S,9S,12R,14S,17S,21R,22S)-22-(2-hydroxypropan-2-yl)-8,8,17-trimethyl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-9-yl]oxy]oxane-3,4-diol.
| Compound Name | (4R,6S)-6-[[(4S,9S,12R,14S,17S,21R,22S)-22-(2-hydroxypropan-2-yl)-8,8,17-trimethyl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-9-yl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 163873506 |
| Molecular Formula | C33H52O7 |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | (4R,6S)-6-[[(4S,9S,12R,14S,17S,21R,22S)-22-(2-hydroxypropan-2-yl)-8,8,17-trimethyl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-9-yl]oxy]oxane-3,4-diol |
| SMILES | CC(C)(O)[C@H]1OC23CC4[C@@H]5CCC6C(C)(C)[C@@H](O[C@H]7C[C@@H](O)C(O)CO7)CC[C@@]67C[C@@]57CC[C@]4(C)C2CC[C@H]1O3 |
| InChI | InChI=1S/C33H52O7/c1-28(2)23-8-6-18-19-15-33-24(9-7-22(39-33)27(40-33)29(3,4)36)30(19,5)12-13-31(18)17-32(23,31)11-10-25(28)38-26-14-20(34)21(35)16-37-26/h18-27,34-36H,6-17H2,1-5H3/t18-,19?,20+,21?,22+,23?,24?,25-,26-,27-,30-,31-,32+,33?/m0/s1 |
| InChIKey | PMWZYSWLMBXCCD-LILLDDGUSA-N |
| XLogP | 4.54 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|