C19H27N3O2 — CID 163875450
N-[3-[(2R)-2-ethylpentoxy]-4-methoxyphenyl]-4-methylpyrimidin-2-amine (PubChem CID 163875450) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[3-[(2R)-2-ethylpentoxy]-4-methoxyphenyl]-4-methylpyrimidin-2-amine.
| Compound Name | N-[3-[(2R)-2-ethylpentoxy]-4-methoxyphenyl]-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 163875450 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-[3-[(2R)-2-ethylpentoxy]-4-methoxyphenyl]-4-methylpyrimidin-2-amine |
| SMILES | CCC[C@@H](CC)COc1cc(Nc2nccc(C)n2)ccc1OC |
| InChI | InChI=1S/C19H27N3O2/c1-5-7-15(6-2)13-24-18-12-16(8-9-17(18)23-4)22-19-20-11-10-14(3)21-19/h8-12,15H,5-7,13H2,1-4H3,(H,20,21,22)/t15-/m1/s1 |
| InChIKey | POLWIHCWEUYLEA-OAHLLOKOSA-N |
| XLogP | 4.74 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |