C19H30IN2O3- — CID 163875679
[(13-aminooxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)-oxidoamino] hypoiodite (PubChem CID 163875679) has the molecular formula C19H30IN2O3- and a molecular weight of 461.36 g/mol. Its IUPAC name is [(13-aminooxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)-oxidoamino] hypoiodite.
| Compound Name | [(13-aminooxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)-oxidoamino] hypoiodite |
|---|---|
| PubChem CID | 163875679 |
| Molecular Formula | C19H30IN2O3- |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [(13-aminooxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)-oxidoamino] hypoiodite |
| SMILES | C=C1CC23CCC4C(C)(CCCC4(C)N([O-])OI)C2CCC1(ON)C3 |
| InChI | InChI=1S/C19H30IN2O3/c1-13-11-18-9-5-14-16(2,7-4-8-17(14,3)22(23)25-20)15(18)6-10-19(13,12-18)24-21/h14-15H,1,4-12,21H2,2-3H3/q-1 |
| InChIKey | TYGAORPJTFXMDT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|