C19H30O — CID 155276840
(1R,4R,5S,9R,10R,13R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-13-ol (PubChem CID 155276840) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (1R,4R,5S,9R,10R,13R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-13-ol.
| Compound Name | (1R,4R,5S,9R,10R,13R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-13-ol |
|---|---|
| PubChem CID | 155276840 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (1R,4R,5S,9R,10R,13R)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-13-ol |
| SMILES | C=C1C[C@@]23CC[C@@H]4[C@@H](C)CCC[C@@]4(C)[C@@H]2CC[C@@]1(O)C3 |
| InChI | InChI=1S/C19H30O/c1-13-5-4-8-17(3)15(13)6-9-18-11-14(2)19(20,12-18)10-7-16(17)18/h13,15-16,20H,2,4-12H2,1,3H3/t13-,15+,16-,17+,18+,19+/m0/s1 |
| InChIKey | FYEVVLBDOVHJFR-RJBYQVBTSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|