C24H33F3O3 — CID 51357242
[(1R,4S,5R,9S,10R,13S)-13-hydroxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl (E)-4,4,4-trifluorobut-2-enoate (PubChem CID 51357242) has the molecular formula C24H33F3O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is [(1R,4S,5R,9S,10R,13S)-13-hydroxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl (E)-4,4,4-trifluorobut-2-enoate.
| Compound Name | [(1R,4S,5R,9S,10R,13S)-13-hydroxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl (E)-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 51357242 |
| Molecular Formula | C24H33F3O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | [(1R,4S,5R,9S,10R,13S)-13-hydroxy-5,9-dimethyl-14-methylidene-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl (E)-4,4,4-trifluorobut-2-enoate |
| SMILES | C=C1C[C@@]23CC[C@@H]4[C@](C)(COC(=O)/C=C/C(F)(F)F)CCC[C@@]4(C)[C@@H]2CC[C@]1(O)C3 |
| InChI | InChI=1S/C24H33F3O3/c1-16-13-22-10-5-17-20(2,15-30-19(28)7-12-24(25,26)27)8-4-9-21(17,3)18(22)6-11-23(16,29)14-22/h7,12,17-18,29H,1,4-6,8-11,13-15H2,2-3H3/b12-7+/t17-,18+,20+,21-,22-,23+/m1/s1 |
| InChIKey | XMJABICETLVLFK-DXPKYQAZSA-N |
| XLogP | 5.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|