C20H32O — CID 163717124
(5S,9R,10R,13S)-5,9,10-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-13-ol (PubChem CID 163717124) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (5S,9R,10R,13S)-5,9,10-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-13-ol.
| Compound Name | (5S,9R,10R,13S)-5,9,10-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-13-ol |
|---|---|
| PubChem CID | 163717124 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (5S,9R,10R,13S)-5,9,10-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-13-ol |
| SMILES | C=C1CC23CCC4[C@@H](C)CCC[C@@]4(C)[C@]2(C)CC[C@]1(O)C3 |
| InChI | InChI=1S/C20H32O/c1-14-6-5-8-17(3)16(14)7-9-19-12-15(2)20(21,13-19)11-10-18(17,19)4/h14,16,21H,2,5-13H2,1,3-4H3/t14-,16?,17+,18-,19?,20-/m0/s1 |
| InChIKey | KOIKFZOTIOKCKC-RFSUHOQXSA-N |
| XLogP | 5.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|