C20H30O — CID 145443522
(5R,13R)-5,13-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbaldehyde (PubChem CID 145443522) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (5R,13R)-5,13-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbaldehyde.
| Compound Name | (5R,13R)-5,13-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbaldehyde |
|---|---|
| PubChem CID | 145443522 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (5R,13R)-5,13-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carbaldehyde |
| SMILES | C=C1CC23CCC4C(CCC[C@@]4(C)C=O)C2CC[C@]1(C)C3 |
| InChI | InChI=1S/C20H30O/c1-14-11-20-10-7-16-15(5-4-8-19(16,3)13-21)17(20)6-9-18(14,2)12-20/h13,15-17H,1,4-12H2,2-3H3/t15?,16?,17?,18-,19+,20?/m1/s1 |
| InChIKey | SXGZYWQUAKQFPV-JHPBPYBXSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|