C19H28O — CID 129230343
(1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde (PubChem CID 129230343) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde.
| Compound Name | (1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde |
|---|---|
| PubChem CID | 129230343 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde |
| SMILES | CC(C)C1=CC2=CC[C@@H]3[C@H](CCC[C@@]3(C)C=O)[C@H]2CC1 |
| InChI | InChI=1S/C19H28O/c1-13(2)14-6-8-16-15(11-14)7-9-18-17(16)5-4-10-19(18,3)12-20/h7,11-13,16-18H,4-6,8-10H2,1-3H3/t16-,17+,18+,19-/m0/s1 |
| InChIKey | BABZAVHYRJHYDM-MANSERQUSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|