C20H32 — CID 157278092
(1S,4aS,4bR,10aS)-1,3,4a-trimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydro-1H-phenanthrene (PubChem CID 157278092) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1S,4aS,4bR,10aS)-1,3,4a-trimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydro-1H-phenanthrene.
| Compound Name | (1S,4aS,4bR,10aS)-1,3,4a-trimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 157278092 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (1S,4aS,4bR,10aS)-1,3,4a-trimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydro-1H-phenanthrene |
| SMILES | CC1C[C@H](C)[C@@H]2CC=C3C=C(C(C)C)CC[C@@H]3[C@@]2(C)C1 |
| InChI | InChI=1S/C20H32/c1-13(2)16-6-9-19-17(11-16)7-8-18-15(4)10-14(3)12-20(18,19)5/h7,11,13-15,18-19H,6,8-10,12H2,1-5H3/t14?,15-,18-,19-,20-/m0/s1 |
| InChIKey | AKQCYMSXZCTUNY-ZGYJVDLSSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |