C19H30NO2P — CID 143482292
(4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydro-1H-phenanthren-1-yl)oxy-methyl-nitrosophosphane (PubChem CID 143482292) has the molecular formula C19H30NO2P and a molecular weight of 335.43 g/mol. Its IUPAC name is (4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydro-1H-phenanthren-1-yl)oxy-methyl-nitrosophosphane.
| Compound Name | (4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydro-1H-phenanthren-1-yl)oxy-methyl-nitrosophosphane |
|---|---|
| PubChem CID | 143482292 |
| Molecular Formula | C19H30NO2P |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (4a-methyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydro-1H-phenanthren-1-yl)oxy-methyl-nitrosophosphane |
| SMILES | CC(C)C1=CC2=CCC3C(OP(C)N=O)CCCC3(C)C2CC1 |
| InChI | InChI=1S/C19H30NO2P/c1-13(2)14-7-9-16-15(12-14)8-10-17-18(22-23(4)20-21)6-5-11-19(16,17)3/h8,12-13,16-18H,5-7,9-11H2,1-4H3 |
| InChIKey | LFZLGLBNKAJMGZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|