About ethylbenzene;phenylsulfanylbenzene;uranium(2+)
ethylbenzene;phenylsulfanylbenzene;uranium(2+) (PubChem CID 163881896) has the molecular formula C20H18SU
and a molecular weight of 528.46 g/mol. Its IUPAC name is ethylbenzene;phenylsulfanylbenzene;uranium(2+).
Molecular Properties
| Compound Name | ethylbenzene;phenylsulfanylbenzene;uranium(2+) |
| PubChem CID | 163881896 |
| Molecular Formula | C20H18SU |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | ethylbenzene;phenylsulfanylbenzene;uranium(2+) |
| SMILES | CCc1[c-]cccc1.[U+2].[c-]1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C12H9S.C8H9.U/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-8-6-4-3-5-7-8;/h1-9H;3-6H,2H2,1H3;/q2*-1;+2 |
| InChIKey | VYZCXRAPTRJLDU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethylbenzene;phenylsulfanylbenzene;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;phenylsulfanylbenzene;uranium(2+)?
The IUPAC name of ethylbenzene;phenylsulfanylbenzene;uranium(2+) (CID 163881896) is ethylbenzene;phenylsulfanylbenzene;uranium(2+).
What is the SMILES notation for ethylbenzene;phenylsulfanylbenzene;uranium(2+)?
The canonical SMILES for ethylbenzene;phenylsulfanylbenzene;uranium(2+) is CCc1[c-]cccc1.[U+2].[c-]1ccccc1Sc1ccccc1.
What is the InChIKey of ethylbenzene;phenylsulfanylbenzene;uranium(2+)?
The InChIKey is VYZCXRAPTRJLDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9S.C8H9.U/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-8-6-4-3-5-7-8;/h1-9H;3-6H,2H2,1H3;/q2*-1;+2.
What are the key properties of ethylbenzene;phenylsulfanylbenzene;uranium(2+)?
ethylbenzene;phenylsulfanylbenzene;uranium(2+) has a molecular weight of 528.46 g/mol, XLogP of 5.69, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;phenylsulfanylbenzene;uranium(2+) is sourced from PubChem (CID 163881896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).