C35H61N5O8 — CID 163882181
29-(3-aminopropyl)-3,5,24,26-tetramethyl-2,6,12,16,21,25,30,34-octaoxaoctacyclo[18.16.0.03,17.05,15.07,13.022,35.024,33.026,31]hexatriacontane-10,10,11,27-tetramine (PubChem CID 163882181) has the molecular formula C35H61N5O8 and a molecular weight of 679.90 g/mol. Its IUPAC name is 29-(3-aminopropyl)-3,5,24,26-tetramethyl-2,6,12,16,21,25,30,34-octaoxaoctacyclo[18.16.0.03,17.05,15.07,13.022,35.024,33.026,31]hexatriacontane-10,10,11,27-tetramine.
| Compound Name | 29-(3-aminopropyl)-3,5,24,26-tetramethyl-2,6,12,16,21,25,30,34-octaoxaoctacyclo[18.16.0.03,17.05,15.07,13.022,35.024,33.026,31]hexatriacontane-10,10,11,27-tetramine |
|---|---|
| PubChem CID | 163882181 |
| Molecular Formula | C35H61N5O8 |
| Molecular Weight | 679.90 g/mol |
| Exact Mass | 679.45 |
| IUPAC Name | 29-(3-aminopropyl)-3,5,24,26-tetramethyl-2,6,12,16,21,25,30,34-octaoxaoctacyclo[18.16.0.03,17.05,15.07,13.022,35.024,33.026,31]hexatriacontane-10,10,11,27-tetramine |
| SMILES | CC12CC3(C)OC4CCC(N)(N)C(N)OC4CC3OC1CCC1OC3CC4(C)OC5(C)C(N)CC(CCCN)OC5CC4OC3CC1O2 |
| InChI | InChI=1S/C35H61N5O8/c1-31-16-24-21(43-28(31)15-29-34(4,48-31)25(37)12-18(41-29)6-5-11-36)13-23-19(42-24)7-8-26-32(2,47-23)17-33(3)27(45-26)14-22-20(46-33)9-10-35(39,40)30(38)44-22/h18-30H,5-17,36-40H2,1-4H3 |
| InChIKey | PUFBUKHUCJSQDH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 203.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.90 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|