C19H34O5 — CID 132528973
[5-[5-[5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pentyl]oxolan-2-yl]oxolan-2-yl]methanol (PubChem CID 132528973) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is [5-[5-[5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pentyl]oxolan-2-yl]oxolan-2-yl]methanol.
| Compound Name | [5-[5-[5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pentyl]oxolan-2-yl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 132528973 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | [5-[5-[5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pentyl]oxolan-2-yl]oxolan-2-yl]methanol |
| SMILES | CC1(C)OC[C@@H](CCCCCC2CCC(C3CCC(CO)O3)O2)O1 |
| InChI | InChI=1S/C19H34O5/c1-19(2)21-13-16(24-19)7-5-3-4-6-14-8-10-17(22-14)18-11-9-15(12-20)23-18/h14-18,20H,3-13H2,1-2H3/t14?,15?,16-,17?,18?/m1/s1 |
| InChIKey | SPMIBKSKBQAYRD-YHGKOVQASA-N |
| XLogP | 3.18 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|