C17H34O4 — CID 143795506
4-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-2-yl]butan-1-ol;ethane (PubChem CID 143795506) has the molecular formula C17H34O4 and a molecular weight of 302.46 g/mol. Its IUPAC name is 4-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-2-yl]butan-1-ol;ethane.
| Compound Name | 4-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-2-yl]butan-1-ol;ethane |
|---|---|
| PubChem CID | 143795506 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 4-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]oxan-2-yl]butan-1-ol;ethane |
| SMILES | CC.CC1(C)OCC(CC2CCCC(CCCCO)O2)O1 |
| InChI | InChI=1S/C15H28O4.C2H6/c1-15(2)17-11-14(19-15)10-13-8-5-7-12(18-13)6-3-4-9-16;1-2/h12-14,16H,3-11H2,1-2H3;1-2H3 |
| InChIKey | GKSUVTGRLCALLX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|