C30H38FN4OS+ — CID 163884042
CID 163884042 (PubChem CID 163884042) has the molecular formula C30H38FN4OS+ and a molecular weight of 521.73 g/mol.
| Compound Name | CID 163884042 |
|---|---|
| PubChem CID | 163884042 |
| Molecular Formula | C30H38FN4OS+ |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | — |
| SMILES | CC(C)NCC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN([SH+](=O)c1ccc(C(C)(C)C)cc1)C2 |
| InChI | InChI=1S/C30H37FN4OS/c1-21(2)32-19-30-17-22-18-33-35(26-10-8-25(31)9-11-26)28(22)16-24(30)14-15-34(20-30)37(36)27-12-6-23(7-13-27)29(3,4)5/h6-13,16,18,21,32H,14-15,17,19-20H2,1-5H3/p+1 |
| InChIKey | PVUASNLSPKLKGA-UHFFFAOYSA-O |
| XLogP | 5.61 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|