C4H16N4OP2 — CID 163886314
1-[amino(methyl)phosphinimyl]-1-[amino(methyl)phosphoryl]ethanamine (PubChem CID 163886314) has the molecular formula C4H16N4OP2 and a molecular weight of 198.15 g/mol. Its IUPAC name is 1-[amino(methyl)phosphinimyl]-1-[amino(methyl)phosphoryl]ethanamine.
| Compound Name | 1-[amino(methyl)phosphinimyl]-1-[amino(methyl)phosphoryl]ethanamine |
|---|---|
| PubChem CID | 163886314 |
| Molecular Formula | C4H16N4OP2 |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-[amino(methyl)phosphinimyl]-1-[amino(methyl)phosphoryl]ethanamine |
| SMILES | [H]N=P(C)(N)C(C)(N)P(C)(N)=O |
| InChI | InChI=1S/C4H16N4OP2/c1-4(5,10(2,6)7)11(3,8)9/h5H2,1-3H3,(H3,6,7)(H2,8,9) |
| InChIKey | PXPVHIVENVHAJY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|