C8H17N2O4P — CID 175415338
(2R)-2-[amino(methyl)phosphoryl]-2-(butanoylamino)propanoic acid (PubChem CID 175415338) has the molecular formula C8H17N2O4P and a molecular weight of 236.21 g/mol. Its IUPAC name is (2R)-2-[amino(methyl)phosphoryl]-2-(butanoylamino)propanoic acid.
| Compound Name | (2R)-2-[amino(methyl)phosphoryl]-2-(butanoylamino)propanoic acid |
|---|---|
| PubChem CID | 175415338 |
| Molecular Formula | C8H17N2O4P |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (2R)-2-[amino(methyl)phosphoryl]-2-(butanoylamino)propanoic acid |
| SMILES | CCCC(=O)N[C@@](C)(C(=O)O)P(C)(N)=O |
| InChI | InChI=1S/C8H17N2O4P/c1-4-5-6(11)10-8(2,7(12)13)15(3,9)14/h4-5H2,1-3H3,(H2,9,14)(H,10,11)(H,12,13)/t8-,15?/m1/s1 |
| InChIKey | VMVHVFLCDROWJV-ARAKYBCZSA-N |
| XLogP | 0.57 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|