C5H10NO7P — CID 173280399
2-(methoxycarbonylamino)-2-phosphonopropanoic acid (PubChem CID 173280399) has the molecular formula C5H10NO7P and a molecular weight of 227.11 g/mol. Its IUPAC name is 2-(methoxycarbonylamino)-2-phosphonopropanoic acid.
| Compound Name | 2-(methoxycarbonylamino)-2-phosphonopropanoic acid |
|---|---|
| PubChem CID | 173280399 |
| Molecular Formula | C5H10NO7P |
| Molecular Weight | 227.11 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 2-(methoxycarbonylamino)-2-phosphonopropanoic acid |
| SMILES | COC(=O)NC(C)(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H10NO7P/c1-5(3(7)8,14(10,11)12)6-4(9)13-2/h1-2H3,(H,6,9)(H,7,8)(H2,10,11,12) |
| InChIKey | FSXIGBOPKLCFHQ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.11 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|