C16H22N2O5 — CID 163886998
(2S)-2-(benzoyloxyamino)-5-morpholin-4-ylpentanoic acid (PubChem CID 163886998) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2S)-2-(benzoyloxyamino)-5-morpholin-4-ylpentanoic acid.
| Compound Name | (2S)-2-(benzoyloxyamino)-5-morpholin-4-ylpentanoic acid |
|---|---|
| PubChem CID | 163886998 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2S)-2-(benzoyloxyamino)-5-morpholin-4-ylpentanoic acid |
| SMILES | O=C(ON[C@@H](CCCN1CCOCC1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O5/c19-15(20)14(7-4-8-18-9-11-22-12-10-18)17-23-16(21)13-5-2-1-3-6-13/h1-3,5-6,14,17H,4,7-12H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | PYFSTTTYUSABHQ-AWEZNQCLSA-N |
| XLogP | 0.91 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|