About CID 163893418
CID 163893418 (PubChem CID 163893418) has the molecular formula C25H15Al2N
and a molecular weight of 383.37 g/mol.
Molecular Properties
| Compound Name | CID 163893418 |
| PubChem CID | 163893418 |
| Molecular Formula | C25H15Al2N |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | — |
| SMILES | [Al]C1c2ccccc2-c2cc(-c3ccc4c(c3)c3ccccc3n4[Al])ccc21 |
| InChI | InChI=1S/C25H15N.2Al/c1-2-6-20-18(5-1)13-19-10-9-16(14-22(19)20)17-11-12-25-23(15-17)21-7-3-4-8-24(21)26-25;;/h1-15H;;/q-1;;+1 |
| InChIKey | MNBKHGHBAYNPJG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 163893418 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163893418?
The IUPAC name of CID 163893418 (CID 163893418) is not available.
What is the SMILES notation for CID 163893418?
The canonical SMILES for CID 163893418 is [Al]C1c2ccccc2-c2cc(-c3ccc4c(c3)c3ccccc3n4[Al])ccc21.
What is the InChIKey of CID 163893418?
The InChIKey is MNBKHGHBAYNPJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H15N.2Al/c1-2-6-20-18(5-1)13-19-10-9-16(14-22(19)20)17-11-12-25-23(15-17)21-7-3-4-8-24(21)26-25;;/h1-15H;;/q-1;;+1.
What are the key properties of CID 163893418?
CID 163893418 has a molecular weight of 383.37 g/mol, XLogP of 5.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163893418 is sourced from PubChem (CID 163893418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).