C8H17NO — CID 163900525
(E,5R)-4-methyl-5-(methylamino)hex-3-en-2-ol (PubChem CID 163900525) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (E,5R)-4-methyl-5-(methylamino)hex-3-en-2-ol.
| Compound Name | (E,5R)-4-methyl-5-(methylamino)hex-3-en-2-ol |
|---|---|
| PubChem CID | 163900525 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (E,5R)-4-methyl-5-(methylamino)hex-3-en-2-ol |
| SMILES | CN[C@H](C)/C(C)=C/C(C)O |
| InChI | InChI=1S/C8H17NO/c1-6(5-7(2)10)8(3)9-4/h5,7-10H,1-4H3/b6-5+/t7?,8-/m1/s1 |
| InChIKey | QJLKPGDXWPTHKM-KGODPFOBSA-N |
| XLogP | 0.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|