C33H34BrN5O — CID 163900718
6-(4-bromophenyl)-N-[4-[2-[4-(2-methoxyethyl)piperazin-1-yl]ethyl]phenyl]benzo[h]quinazolin-2-amine (PubChem CID 163900718) has the molecular formula C33H34BrN5O and a molecular weight of 596.57 g/mol. Its IUPAC name is 6-(4-bromophenyl)-N-[4-[2-[4-(2-methoxyethyl)piperazin-1-yl]ethyl]phenyl]benzo[h]quinazolin-2-amine.
| Compound Name | 6-(4-bromophenyl)-N-[4-[2-[4-(2-methoxyethyl)piperazin-1-yl]ethyl]phenyl]benzo[h]quinazolin-2-amine |
|---|---|
| PubChem CID | 163900718 |
| Molecular Formula | C33H34BrN5O |
| Molecular Weight | 596.57 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | 6-(4-bromophenyl)-N-[4-[2-[4-(2-methoxyethyl)piperazin-1-yl]ethyl]phenyl]benzo[h]quinazolin-2-amine |
| SMILES | COCCN1CCN(CCc2ccc(Nc3ncc4cc(-c5ccc(Br)cc5)c5ccccc5c4n3)cc2)CC1 |
| InChI | InChI=1S/C33H34BrN5O/c1-40-21-20-39-18-16-38(17-19-39)15-14-24-6-12-28(13-7-24)36-33-35-23-26-22-31(25-8-10-27(34)11-9-25)29-4-2-3-5-30(29)32(26)37-33/h2-13,22-23H,14-21H2,1H3,(H,35,36,37) |
| InChIKey | QJPVJWVLZHKCKC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.57 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|