C27H27F2N5O — CID 141446359
7-fluoro-N-[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]-8-phenylquinazolin-2-amine (PubChem CID 141446359) has the molecular formula C27H27F2N5O and a molecular weight of 475.54 g/mol. Its IUPAC name is 7-fluoro-N-[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]-8-phenylquinazolin-2-amine.
| Compound Name | 7-fluoro-N-[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]-8-phenylquinazolin-2-amine |
|---|---|
| PubChem CID | 141446359 |
| Molecular Formula | C27H27F2N5O |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 7-fluoro-N-[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]-8-phenylquinazolin-2-amine |
| SMILES | COCCN1CCN(c2ccc(Nc3ncc4ccc(F)c(-c5ccccc5)c4n3)cc2F)CC1 |
| InChI | InChI=1S/C27H27F2N5O/c1-35-16-15-33-11-13-34(14-12-33)24-10-8-21(17-23(24)29)31-27-30-18-20-7-9-22(28)25(26(20)32-27)19-5-3-2-4-6-19/h2-10,17-18H,11-16H2,1H3,(H,30,31,32) |
| InChIKey | IGRJWDCUOFSFOT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|