About CID 163902651
CID 163902651 (PubChem CID 163902651) has the molecular formula C22H32IO2-
and a molecular weight of 455.40 g/mol.
Molecular Properties
| Compound Name | CID 163902651 |
| PubChem CID | 163902651 |
| Molecular Formula | C22H32IO2- |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C(O)c2ccc(OCCCCC[I-](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H32IO2/c1-18-8-10-19(11-9-18)22(24)20-12-14-21(15-13-20)25-17-7-5-6-16-23(2,3)4/h8-15,22,24H,5-7,16-17H2,1-4H3/q-1 |
| InChIKey | JJOOSKKFGUXAER-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163902651 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163902651?
The IUPAC name of CID 163902651 (CID 163902651) is not available.
What is the SMILES notation for CID 163902651?
The canonical SMILES for CID 163902651 is Cc1ccc(C(O)c2ccc(OCCCCC[I-](C)(C)C)cc2)cc1.
What is the InChIKey of CID 163902651?
The InChIKey is JJOOSKKFGUXAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32IO2/c1-18-8-10-19(11-9-18)22(24)20-12-14-21(15-13-20)25-17-7-5-6-16-23(2,3)4/h8-15,22,24H,5-7,16-17H2,1-4H3/q-1.
What are the key properties of CID 163902651?
CID 163902651 has a molecular weight of 455.40 g/mol, XLogP of 1.68, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163902651 is sourced from PubChem (CID 163902651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).