C14H19BrFNO — CID 163902812
(3S)-3-(4-bromo-2-fluorophenyl)-4-(cyclopropylmethylamino)butan-2-ol (PubChem CID 163902812) has the molecular formula C14H19BrFNO and a molecular weight of 316.21 g/mol. Its IUPAC name is (3S)-3-(4-bromo-2-fluorophenyl)-4-(cyclopropylmethylamino)butan-2-ol.
| Compound Name | (3S)-3-(4-bromo-2-fluorophenyl)-4-(cyclopropylmethylamino)butan-2-ol |
|---|---|
| PubChem CID | 163902812 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (3S)-3-(4-bromo-2-fluorophenyl)-4-(cyclopropylmethylamino)butan-2-ol |
| SMILES | CC(O)[C@H](CNCC1CC1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C14H19BrFNO/c1-9(18)13(8-17-7-10-2-3-10)12-5-4-11(15)6-14(12)16/h4-6,9-10,13,17-18H,2-3,7-8H2,1H3/t9?,13-/m0/s1 |
| InChIKey | QLIPAXAPUZUIFD-NCWAPJAISA-N |
| XLogP | 3.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |